C16H28BN2O3 — CID 123144358
CID 123144358 (PubChem CID 123144358) has the molecular formula C16H28BN2O3 and a molecular weight of 307.22 g/mol.
| Compound Name | CID 123144358 |
|---|---|
| PubChem CID | 123144358 |
| Molecular Formula | C16H28BN2O3 |
| Molecular Weight | 307.22 g/mol |
| Exact Mass | 307.22 |
| IUPAC Name | — |
| SMILES | CN(C)CCCOc1ccc([B]OC(C)(C)C(C)(C)O)cn1 |
| InChI | InChI=1S/C16H28BN2O3/c1-15(2,20)16(3,4)22-17-13-8-9-14(18-12-13)21-11-7-10-19(5)6/h8-9,12,20H,7,10-11H2,1-6H3 |
| InChIKey | ISGPCOTUBKBOHD-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 54.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.22 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|