C28H47FIN4O4Si2+ — CID 123144545
ethyl 2-[4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-iodo-2H-pyrazolo[1,5-a]pyrimidin-2-ylium-5-yl]cyclohexyl]-2-fluoroacetate (PubChem CID 123144545) has the molecular formula C28H47FIN4O4Si2+ and a molecular weight of 705.78 g/mol. Its IUPAC name is ethyl 2-[4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-iodo-2H-pyrazolo[1,5-a]pyrimidin-2-ylium-5-yl]cyclohexyl]-2-fluoroacetate.
| Compound Name | ethyl 2-[4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-iodo-2H-pyrazolo[1,5-a]pyrimidin-2-ylium-5-yl]cyclohexyl]-2-fluoroacetate |
|---|---|
| PubChem CID | 123144545 |
| Molecular Formula | C28H47FIN4O4Si2+ |
| Molecular Weight | 705.78 g/mol |
| Exact Mass | 705.22 |
| IUPAC Name | ethyl 2-[4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-iodo-2H-pyrazolo[1,5-a]pyrimidin-2-ylium-5-yl]cyclohexyl]-2-fluoroacetate |
| SMILES | CCOC(=O)C(F)C1CCC(C2=NC3=C(I)[C+]=NN3C(N(COCC[Si](C)(C)C)COCC[Si](C)(C)C)=C2)CC1 |
| InChI | InChI=1S/C28H47FIN4O4Si2/c1-8-38-28(35)26(29)22-11-9-21(10-12-22)24-17-25(34-27(32-24)23(30)18-31-34)33(19-36-13-15-39(2,3)4)20-37-14-16-40(5,6)7/h17,21-22,26H,8-16,19-20H2,1-7H3/q+1 |
| InChIKey | AVFNHQHJDHLAKJ-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 75.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.78 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|