C10H16O — CID 123144803
2-methylidene-3,4,4a,5,6,7,8,8a-octahydrochromene (PubChem CID 123144803) has the molecular formula C10H16O and a molecular weight of 152.24 g/mol. Its IUPAC name is 2-methylidene-3,4,4a,5,6,7,8,8a-octahydrochromene.
| Compound Name | 2-methylidene-3,4,4a,5,6,7,8,8a-octahydrochromene |
|---|---|
| PubChem CID | 123144803 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | 2-methylidene-3,4,4a,5,6,7,8,8a-octahydrochromene |
| SMILES | C=C1CCC2CCCCC2O1 |
| InChI | InChI=1S/C10H16O/c1-8-6-7-9-4-2-3-5-10(9)11-8/h9-10H,1-7H2 |
| InChIKey | XDJTWGFBSICHCN-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |