About N-hexa-1,3,5-trien-3-yl-N-methylcyclohexanecarboxamide
N-hexa-1,3,5-trien-3-yl-N-methylcyclohexanecarboxamide (PubChem CID 123145825) has the molecular formula C14H21NO
and a molecular weight of 219.33 g/mol. Its IUPAC name is N-hexa-1,3,5-trien-3-yl-N-methylcyclohexanecarboxamide.
Molecular Properties
| Compound Name | N-hexa-1,3,5-trien-3-yl-N-methylcyclohexanecarboxamide |
| PubChem CID | 123145825 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | N-hexa-1,3,5-trien-3-yl-N-methylcyclohexanecarboxamide |
| SMILES | C=CC=C(C=C)N(C)C(=O)C1CCCCC1 |
| InChI | InChI=1S/C14H21NO/c1-4-9-13(5-2)15(3)14(16)12-10-7-6-8-11-12/h4-5,9,12H,1-2,6-8,10-11H2,3H3 |
| InChIKey | KZBHWWDXMVNKQE-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-hexa-1,3,5-trien-3-yl-N-methylcyclohexanecarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hexa-1,3,5-trien-3-yl-N-methylcyclohexanecarboxamide?
The IUPAC name of N-hexa-1,3,5-trien-3-yl-N-methylcyclohexanecarboxamide (CID 123145825) is N-hexa-1,3,5-trien-3-yl-N-methylcyclohexanecarboxamide.
What is the SMILES notation for N-hexa-1,3,5-trien-3-yl-N-methylcyclohexanecarboxamide?
The canonical SMILES for N-hexa-1,3,5-trien-3-yl-N-methylcyclohexanecarboxamide is C=CC=C(C=C)N(C)C(=O)C1CCCCC1.
What is the InChIKey of N-hexa-1,3,5-trien-3-yl-N-methylcyclohexanecarboxamide?
The InChIKey is KZBHWWDXMVNKQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO/c1-4-9-13(5-2)15(3)14(16)12-10-7-6-8-11-12/h4-5,9,12H,1-2,6-8,10-11H2,3H3.
What are the key properties of N-hexa-1,3,5-trien-3-yl-N-methylcyclohexanecarboxamide?
N-hexa-1,3,5-trien-3-yl-N-methylcyclohexanecarboxamide has a molecular weight of 219.33 g/mol, XLogP of 3.28, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-hexa-1,3,5-trien-3-yl-N-methylcyclohexanecarboxamide is sourced from PubChem (CID 123145825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).