About N-methyl-N-penta-1,3-dien-3-ylcyclohexanecarboxamide
N-methyl-N-penta-1,3-dien-3-ylcyclohexanecarboxamide (PubChem CID 123818181) has the molecular formula C13H21NO
and a molecular weight of 207.32 g/mol. Its IUPAC name is N-methyl-N-penta-1,3-dien-3-ylcyclohexanecarboxamide.
Molecular Properties
| Compound Name | N-methyl-N-penta-1,3-dien-3-ylcyclohexanecarboxamide |
| PubChem CID | 123818181 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | N-methyl-N-penta-1,3-dien-3-ylcyclohexanecarboxamide |
| SMILES | C=CC(=CC)N(C)C(=O)C1CCCCC1 |
| InChI | InChI=1S/C13H21NO/c1-4-12(5-2)14(3)13(15)11-9-7-6-8-10-11/h4-5,11H,1,6-10H2,2-3H3 |
| InChIKey | UQKNBFMWGJNHHW-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-N-penta-1,3-dien-3-ylcyclohexanecarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-penta-1,3-dien-3-ylcyclohexanecarboxamide?
The IUPAC name of N-methyl-N-penta-1,3-dien-3-ylcyclohexanecarboxamide (CID 123818181) is N-methyl-N-penta-1,3-dien-3-ylcyclohexanecarboxamide.
What is the SMILES notation for N-methyl-N-penta-1,3-dien-3-ylcyclohexanecarboxamide?
The canonical SMILES for N-methyl-N-penta-1,3-dien-3-ylcyclohexanecarboxamide is C=CC(=CC)N(C)C(=O)C1CCCCC1.
What is the InChIKey of N-methyl-N-penta-1,3-dien-3-ylcyclohexanecarboxamide?
The InChIKey is UQKNBFMWGJNHHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21NO/c1-4-12(5-2)14(3)13(15)11-9-7-6-8-10-11/h4-5,11H,1,6-10H2,2-3H3.
What are the key properties of N-methyl-N-penta-1,3-dien-3-ylcyclohexanecarboxamide?
N-methyl-N-penta-1,3-dien-3-ylcyclohexanecarboxamide has a molecular weight of 207.32 g/mol, XLogP of 3.11, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-penta-1,3-dien-3-ylcyclohexanecarboxamide is sourced from PubChem (CID 123818181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).