C28H35N5O — CID 123146941
7-(3,4-dimethylpiperazin-1-yl)-2-[(7E,9Z)-10-ethyl-2-methyl-3,4,5,6-tetrahydrocycloocta[b]pyridin-8-yl]pyrido[1,2-a]pyrimidin-4-one (PubChem CID 123146941) has the molecular formula C28H35N5O and a molecular weight of 457.62 g/mol. Its IUPAC name is 7-(3,4-dimethylpiperazin-1-yl)-2-[(7E,9Z)-10-ethyl-2-methyl-3,4,5,6-tetrahydrocycloocta[b]pyridin-8-yl]pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 7-(3,4-dimethylpiperazin-1-yl)-2-[(7E,9Z)-10-ethyl-2-methyl-3,4,5,6-tetrahydrocycloocta[b]pyridin-8-yl]pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 123146941 |
| Molecular Formula | C28H35N5O |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.28 |
| IUPAC Name | 7-(3,4-dimethylpiperazin-1-yl)-2-[(7E,9Z)-10-ethyl-2-methyl-3,4,5,6-tetrahydrocycloocta[b]pyridin-8-yl]pyrido[1,2-a]pyrimidin-4-one |
| SMILES | CC/C1=C/C(c2cc(=O)n3cc(N4CCN(C)C(C)C4)ccc3n2)=C\CCC2=C1N=C(C)CC2 |
| InChI | InChI=1S/C28H35N5O/c1-5-21-15-23(8-6-7-22-10-9-19(2)29-28(21)22)25-16-27(34)33-18-24(11-12-26(33)30-25)32-14-13-31(4)20(3)17-32/h8,11-12,15-16,18,20H,5-7,9-10,13-14,17H2,1-4H3/b21-15-,23-8+ |
| InChIKey | RWCUPLFLKINSST-SWMQJUNMSA-N |
| XLogP | 4.86 |
| TPSA | 53.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |