C30H41N5O — CID 142510985
2-[(3Z)-4-imino-3-pentylidenecyclohexa-1,5-dien-1-yl]-9-methyl-7-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyrido[1,2-a]pyrimidin-4-one (PubChem CID 142510985) has the molecular formula C30H41N5O and a molecular weight of 487.69 g/mol. Its IUPAC name is 2-[(3Z)-4-imino-3-pentylidenecyclohexa-1,5-dien-1-yl]-9-methyl-7-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-[(3Z)-4-imino-3-pentylidenecyclohexa-1,5-dien-1-yl]-9-methyl-7-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 142510985 |
| Molecular Formula | C30H41N5O |
| Molecular Weight | 487.69 g/mol |
| Exact Mass | 487.33 |
| IUPAC Name | 2-[(3Z)-4-imino-3-pentylidenecyclohexa-1,5-dien-1-yl]-9-methyl-7-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyrido[1,2-a]pyrimidin-4-one |
| SMILES | [H]/N=C1\C=CC(c2cc(=O)n3cc(N(C)C4CC(C)(C)NC(C)(C)C4)cc(C)c3n2)=C\C1=C\CCCC |
| InChI | InChI=1S/C30H41N5O/c1-8-9-10-11-21-15-22(12-13-25(21)31)26-16-27(36)35-19-23(14-20(2)28(35)32-26)34(7)24-17-29(3,4)33-30(5,6)18-24/h11-16,19,24,31,33H,8-10,17-18H2,1-7H3/b21-11-,31-25+ |
| InChIKey | QHVTWAKSACSPQI-HIVWKOSXSA-N |
| XLogP | 5.84 |
| TPSA | 73.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.69 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|