C25H19ClF6O — CID 123148079
5-[4-[(4-chloro-3,5-difluorophenoxy)-difluoromethyl]-3,5-difluorophenyl]-2-propyl-2,3-dihydro-1H-indene (PubChem CID 123148079) has the molecular formula C25H19ClF6O and a molecular weight of 484.87 g/mol. Its IUPAC name is 5-[4-[(4-chloro-3,5-difluorophenoxy)-difluoromethyl]-3,5-difluorophenyl]-2-propyl-2,3-dihydro-1H-indene.
| Compound Name | 5-[4-[(4-chloro-3,5-difluorophenoxy)-difluoromethyl]-3,5-difluorophenyl]-2-propyl-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 123148079 |
| Molecular Formula | C25H19ClF6O |
| Molecular Weight | 484.87 g/mol |
| Exact Mass | 484.10 |
| IUPAC Name | 5-[4-[(4-chloro-3,5-difluorophenoxy)-difluoromethyl]-3,5-difluorophenyl]-2-propyl-2,3-dihydro-1H-indene |
| SMILES | CCCC1Cc2ccc(-c3cc(F)c(C(F)(F)Oc4cc(F)c(Cl)c(F)c4)c(F)c3)cc2C1 |
| InChI | InChI=1S/C25H19ClF6O/c1-2-3-13-6-14-4-5-15(8-16(14)7-13)17-9-19(27)23(20(28)10-17)25(31,32)33-18-11-21(29)24(26)22(30)12-18/h4-5,8-13H,2-3,6-7H2,1H3 |
| InChIKey | MPSJZIRDPRGLCN-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.87 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|