C33H27F7O — CID 175685243
5-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]phenyl]-2-pentyl-2,3-dihydro-1H-indene (PubChem CID 175685243) has the molecular formula C33H27F7O and a molecular weight of 572.56 g/mol. Its IUPAC name is 5-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]phenyl]-2-pentyl-2,3-dihydro-1H-indene.
| Compound Name | 5-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]phenyl]-2-pentyl-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 175685243 |
| Molecular Formula | C33H27F7O |
| Molecular Weight | 572.56 g/mol |
| Exact Mass | 572.20 |
| IUPAC Name | 5-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]phenyl]-2-pentyl-2,3-dihydro-1H-indene |
| SMILES | CCCCCC1Cc2ccc(-c3ccc(-c4cc(F)c(C(F)(F)Oc5cc(F)c(F)c(F)c5)c(F)c4)cc3)cc2C1 |
| InChI | InChI=1S/C33H27F7O/c1-2-3-4-5-19-12-22-10-11-23(14-24(22)13-19)20-6-8-21(9-7-20)25-15-27(34)31(28(35)16-25)33(39,40)41-26-17-29(36)32(38)30(37)18-26/h6-11,14-19H,2-5,12-13H2,1H3 |
| InChIKey | JIVQOZBSDYZLFG-UHFFFAOYSA-N |
| XLogP | 10.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.56 |
| LogP ≤ 5 | 10.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|