C15H18 — CID 123149212
2-methyl-5-methylidene-6-(2-prop-1-en-2-ylbut-2-enylidene)cyclohexa-1,3-diene (PubChem CID 123149212) has the molecular formula C15H18 and a molecular weight of 198.31 g/mol. Its IUPAC name is 2-methyl-5-methylidene-6-(2-prop-1-en-2-ylbut-2-enylidene)cyclohexa-1,3-diene.
| Compound Name | 2-methyl-5-methylidene-6-(2-prop-1-en-2-ylbut-2-enylidene)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 123149212 |
| Molecular Formula | C15H18 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 2-methyl-5-methylidene-6-(2-prop-1-en-2-ylbut-2-enylidene)cyclohexa-1,3-diene |
| SMILES | C=C(C)C(=CC)C=c1cc(C)ccc1=C |
| InChI | InChI=1S/C15H18/c1-6-14(11(2)3)10-15-9-12(4)7-8-13(15)5/h6-10H,2,5H2,1,3-4H3 |
| InChIKey | HXBHJBFCIDJEDZ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|