About (2E)-3,6-dimethylidene-2-[(E)-2-prop-1-en-2-ylbut-2-enylidene]piperidine
(2E)-3,6-dimethylidene-2-[(E)-2-prop-1-en-2-ylbut-2-enylidene]piperidine (PubChem CID 143343260) has the molecular formula C14H19N
and a molecular weight of 201.31 g/mol. Its IUPAC name is (2E)-3,6-dimethylidene-2-[(E)-2-prop-1-en-2-ylbut-2-enylidene]piperidine.
Molecular Properties
| Compound Name | (2E)-3,6-dimethylidene-2-[(E)-2-prop-1-en-2-ylbut-2-enylidene]piperidine |
| PubChem CID | 143343260 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | (2E)-3,6-dimethylidene-2-[(E)-2-prop-1-en-2-ylbut-2-enylidene]piperidine |
| SMILES | C=C1CCC(=C)/C(=C/C(=C\C)C(=C)C)N1 |
| InChI | InChI=1S/C14H19N/c1-6-13(10(2)3)9-14-11(4)7-8-12(5)15-14/h6,9,15H,2,4-5,7-8H2,1,3H3/b13-6+,14-9+ |
| InChIKey | REIOZZYOYBPCRA-SJRHNVSNSA-N |
| XLogP | 3.85 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-3,6-dimethylidene-2-[(E)-2-prop-1-en-2-ylbut-2-enylidene]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-3,6-dimethylidene-2-[(E)-2-prop-1-en-2-ylbut-2-enylidene]piperidine?
The IUPAC name of (2E)-3,6-dimethylidene-2-[(E)-2-prop-1-en-2-ylbut-2-enylidene]piperidine (CID 143343260) is (2E)-3,6-dimethylidene-2-[(E)-2-prop-1-en-2-ylbut-2-enylidene]piperidine.
What is the SMILES notation for (2E)-3,6-dimethylidene-2-[(E)-2-prop-1-en-2-ylbut-2-enylidene]piperidine?
The canonical SMILES for (2E)-3,6-dimethylidene-2-[(E)-2-prop-1-en-2-ylbut-2-enylidene]piperidine is C=C1CCC(=C)/C(=C/C(=C\C)C(=C)C)N1.
What is the InChIKey of (2E)-3,6-dimethylidene-2-[(E)-2-prop-1-en-2-ylbut-2-enylidene]piperidine?
The InChIKey is REIOZZYOYBPCRA-SJRHNVSNSA-N. The full InChI is InChI=1S/C14H19N/c1-6-13(10(2)3)9-14-11(4)7-8-12(5)15-14/h6,9,15H,2,4-5,7-8H2,1,3H3/b13-6+,14-9+.
What are the key properties of (2E)-3,6-dimethylidene-2-[(E)-2-prop-1-en-2-ylbut-2-enylidene]piperidine?
(2E)-3,6-dimethylidene-2-[(E)-2-prop-1-en-2-ylbut-2-enylidene]piperidine has a molecular weight of 201.31 g/mol, XLogP of 3.85, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-3,6-dimethylidene-2-[(E)-2-prop-1-en-2-ylbut-2-enylidene]piperidine is sourced from PubChem (CID 143343260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).