C24H22Cl2N4O4S — CID 123149229
2,6-dichloro-4-[4-[[6-[2-(methylamino)ethoxy]-3-pyridinyl]amino]-3-methylsulfonylquinolin-6-yl]phenol (PubChem CID 123149229) has the molecular formula C24H22Cl2N4O4S and a molecular weight of 533.44 g/mol. Its IUPAC name is 2,6-dichloro-4-[4-[[6-[2-(methylamino)ethoxy]-3-pyridinyl]amino]-3-methylsulfonylquinolin-6-yl]phenol.
| Compound Name | 2,6-dichloro-4-[4-[[6-[2-(methylamino)ethoxy]-3-pyridinyl]amino]-3-methylsulfonylquinolin-6-yl]phenol |
|---|---|
| PubChem CID | 123149229 |
| Molecular Formula | C24H22Cl2N4O4S |
| Molecular Weight | 533.44 g/mol |
| Exact Mass | 532.07 |
| IUPAC Name | 2,6-dichloro-4-[4-[[6-[2-(methylamino)ethoxy]-3-pyridinyl]amino]-3-methylsulfonylquinolin-6-yl]phenol |
| SMILES | CNCCOc1ccc(Nc2c(S(C)(=O)=O)cnc3ccc(-c4cc(Cl)c(O)c(Cl)c4)cc23)cn1 |
| InChI | InChI=1S/C24H22Cl2N4O4S/c1-27-7-8-34-22-6-4-16(12-29-22)30-23-17-9-14(15-10-18(25)24(31)19(26)11-15)3-5-20(17)28-13-21(23)35(2,32)33/h3-6,9-13,27,31H,7-8H2,1-2H3,(H,28,30) |
| InChIKey | RYOVIEAEBIPRIP-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 113.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.44 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|