C29H32F3NO5S — CID 123152287
3,4-dimethyl-5-[(2-morpholin-4-ylsulfonylphenyl)methyl]-7-phenyl-6-(2,2,2-trifluoroethyl)octa-2,4,6-trienoic acid (PubChem CID 123152287) has the molecular formula C29H32F3NO5S and a molecular weight of 563.64 g/mol. Its IUPAC name is 3,4-dimethyl-5-[(2-morpholin-4-ylsulfonylphenyl)methyl]-7-phenyl-6-(2,2,2-trifluoroethyl)octa-2,4,6-trienoic acid.
| Compound Name | 3,4-dimethyl-5-[(2-morpholin-4-ylsulfonylphenyl)methyl]-7-phenyl-6-(2,2,2-trifluoroethyl)octa-2,4,6-trienoic acid |
|---|---|
| PubChem CID | 123152287 |
| Molecular Formula | C29H32F3NO5S |
| Molecular Weight | 563.64 g/mol |
| Exact Mass | 563.20 |
| IUPAC Name | 3,4-dimethyl-5-[(2-morpholin-4-ylsulfonylphenyl)methyl]-7-phenyl-6-(2,2,2-trifluoroethyl)octa-2,4,6-trienoic acid |
| SMILES | CC(=CC(=O)O)C(C)=C(Cc1ccccc1S(=O)(=O)N1CCOCC1)C(CC(F)(F)F)=C(C)c1ccccc1 |
| InChI | InChI=1S/C29H32F3NO5S/c1-20(17-28(34)35)21(2)25(26(19-29(30,31)32)22(3)23-9-5-4-6-10-23)18-24-11-7-8-12-27(24)39(36,37)33-13-15-38-16-14-33/h4-12,17H,13-16,18-19H2,1-3H3,(H,34,35) |
| InChIKey | NEUCRBUBSWJEEB-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.64 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|