C30H46N2O2Si — CID 123156254
1-[8-[tert-butyl(diphenyl)silyl]oxyoct-5-enyl]-3-pentylurea (PubChem CID 123156254) has the molecular formula C30H46N2O2Si and a molecular weight of 494.80 g/mol. Its IUPAC name is 1-[8-[tert-butyl(diphenyl)silyl]oxyoct-5-enyl]-3-pentylurea.
| Compound Name | 1-[8-[tert-butyl(diphenyl)silyl]oxyoct-5-enyl]-3-pentylurea |
|---|---|
| PubChem CID | 123156254 |
| Molecular Formula | C30H46N2O2Si |
| Molecular Weight | 494.80 g/mol |
| Exact Mass | 494.33 |
| IUPAC Name | 1-[8-[tert-butyl(diphenyl)silyl]oxyoct-5-enyl]-3-pentylurea |
| SMILES | CCCCCNC(=O)NCCCCC=CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C30H46N2O2Si/c1-5-6-17-24-31-29(33)32-25-18-9-7-8-10-19-26-34-35(30(2,3)4,27-20-13-11-14-21-27)28-22-15-12-16-23-28/h8,10-16,20-23H,5-7,9,17-19,24-26H2,1-4H3,(H2,31,32,33) |
| InChIKey | WEAZLRGWXKIHPG-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.80 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|