C10H15O3+ — CID 123156695
3-methyl-4-(2-methylbutan-2-yl)oxolane-2,5-dione (PubChem CID 123156695) has the molecular formula C10H15O3+ and a molecular weight of 183.23 g/mol. Its IUPAC name is 3-methyl-4-(2-methylbutan-2-yl)oxolane-2,5-dione.
| Compound Name | 3-methyl-4-(2-methylbutan-2-yl)oxolane-2,5-dione |
|---|---|
| PubChem CID | 123156695 |
| Molecular Formula | C10H15O3+ |
| Molecular Weight | 183.23 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | 3-methyl-4-(2-methylbutan-2-yl)oxolane-2,5-dione |
| SMILES | [CH2+]C1C(=O)OC(=O)C1C(C)(C)CC |
| InChI | InChI=1S/C10H15O3/c1-5-10(3,4)7-6(2)8(11)13-9(7)12/h6-7H,2,5H2,1,3-4H3/q+1 |
| InChIKey | AJPDAJVVRXYYBN-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.23 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|