C21H38O3 — CID 167011648
3-tert-butyl-4-(2,3,3,4,6,6-hexamethylheptan-2-yl)oxolane-2,5-dione (PubChem CID 167011648) has the molecular formula C21H38O3 and a molecular weight of 338.53 g/mol. Its IUPAC name is 3-tert-butyl-4-(2,3,3,4,6,6-hexamethylheptan-2-yl)oxolane-2,5-dione.
| Compound Name | 3-tert-butyl-4-(2,3,3,4,6,6-hexamethylheptan-2-yl)oxolane-2,5-dione |
|---|---|
| PubChem CID | 167011648 |
| Molecular Formula | C21H38O3 |
| Molecular Weight | 338.53 g/mol |
| Exact Mass | 338.28 |
| IUPAC Name | 3-tert-butyl-4-(2,3,3,4,6,6-hexamethylheptan-2-yl)oxolane-2,5-dione |
| SMILES | CC(CC(C)(C)C)C(C)(C)C(C)(C)C1C(=O)OC(=O)C1C(C)(C)C |
| InChI | InChI=1S/C21H38O3/c1-13(12-18(2,3)4)20(8,9)21(10,11)15-14(19(5,6)7)16(22)24-17(15)23/h13-15H,12H2,1-11H3 |
| InChIKey | GTPLNSBGQRHDAL-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.53 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|