C10H16N2 — CID 123161081
3-ethyl-6,7-dimethyl-3,4-dihydroazepin-5-imine (PubChem CID 123161081) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is 3-ethyl-6,7-dimethyl-3,4-dihydroazepin-5-imine.
| Compound Name | 3-ethyl-6,7-dimethyl-3,4-dihydroazepin-5-imine |
|---|---|
| PubChem CID | 123161081 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | 3-ethyl-6,7-dimethyl-3,4-dihydroazepin-5-imine |
| SMILES | [H]/N=C1\CC(CC)C=NC(C)=C1C |
| InChI | InChI=1S/C10H16N2/c1-4-9-5-10(11)7(2)8(3)12-6-9/h6,9,11H,4-5H2,1-3H3/b11-10+ |
| InChIKey | ORBHUKBGERJBOR-ZHACJKMWSA-N |
| XLogP | 2.80 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|