C16H38Cl2N5O+ — CID 123161262
2-[(2,8-diamino-8-imino-2-methyloctanoyl)amino]ethyl-diethyl-methylazanium;dihydrochloride (PubChem CID 123161262) has the molecular formula C16H38Cl2N5O+ and a molecular weight of 387.42 g/mol. Its IUPAC name is 2-[(2,8-diamino-8-imino-2-methyloctanoyl)amino]ethyl-diethyl-methylazanium;dihydrochloride.
| Compound Name | 2-[(2,8-diamino-8-imino-2-methyloctanoyl)amino]ethyl-diethyl-methylazanium;dihydrochloride |
|---|---|
| PubChem CID | 123161262 |
| Molecular Formula | C16H38Cl2N5O+ |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | 2-[(2,8-diamino-8-imino-2-methyloctanoyl)amino]ethyl-diethyl-methylazanium;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(\N)CCCCCC(C)(N)C(=O)NCC[N+](C)(CC)CC |
| InChI | InChI=1S/C16H35N5O.2ClH/c1-5-21(4,6-2)13-12-20-15(22)16(3,19)11-9-7-8-10-14(17)18;;/h5-13,19H2,1-4H3,(H3-,17,18,20,22);2*1H/p+1 |
| InChIKey | FCXUGSFPCUMRAX-UHFFFAOYSA-O |
| XLogP | 2.04 |
| TPSA | 104.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|