C17H38ClN4O+ — CID 123721188
2-[(2-amino-8-imino-2-methylnonanoyl)amino]ethyl-diethyl-methylazanium;hydrochloride (PubChem CID 123721188) has the molecular formula C17H38ClN4O+ and a molecular weight of 349.97 g/mol. Its IUPAC name is 2-[(2-amino-8-imino-2-methylnonanoyl)amino]ethyl-diethyl-methylazanium;hydrochloride.
| Compound Name | 2-[(2-amino-8-imino-2-methylnonanoyl)amino]ethyl-diethyl-methylazanium;hydrochloride |
|---|---|
| PubChem CID | 123721188 |
| Molecular Formula | C17H38ClN4O+ |
| Molecular Weight | 349.97 g/mol |
| Exact Mass | 349.27 |
| IUPAC Name | 2-[(2-amino-8-imino-2-methylnonanoyl)amino]ethyl-diethyl-methylazanium;hydrochloride |
| SMILES | Cl.[H]/N=C(\C)CCCCCC(C)(N)C(=O)NCC[N+](C)(CC)CC |
| InChI | InChI=1S/C17H36N4O.ClH/c1-6-21(5,7-2)14-13-20-16(22)17(4,19)12-10-8-9-11-15(3)18;/h18H,6-14,19H2,1-5H3;1H/p+1/b18-15+; |
| InChIKey | UEQFXIPEPCPGJA-FLNCGGNMSA-O |
| XLogP | 2.72 |
| TPSA | 78.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.97 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|