C18H40Cl2N6O — CID 161138817
2-[[8-amino-2-(1-aminoethylideneamino)-8-imino-2-methyloctanoyl]amino]ethyl-diethyl-methylazanium;chloride;hydrochloride (PubChem CID 161138817) has the molecular formula C18H40Cl2N6O and a molecular weight of 427.47 g/mol. Its IUPAC name is 2-[[8-amino-2-(1-aminoethylideneamino)-8-imino-2-methyloctanoyl]amino]ethyl-diethyl-methylazanium;chloride;hydrochloride.
| Compound Name | 2-[[8-amino-2-(1-aminoethylideneamino)-8-imino-2-methyloctanoyl]amino]ethyl-diethyl-methylazanium;chloride;hydrochloride |
|---|---|
| PubChem CID | 161138817 |
| Molecular Formula | C18H40Cl2N6O |
| Molecular Weight | 427.47 g/mol |
| Exact Mass | 426.26 |
| IUPAC Name | 2-[[8-amino-2-(1-aminoethylideneamino)-8-imino-2-methyloctanoyl]amino]ethyl-diethyl-methylazanium;chloride;hydrochloride |
| SMILES | Cl.[Cl-].[H]/N=C(\N)CCCCCC(C)(/N=C(\C)N)C(=O)NCC[N+](C)(CC)CC |
| InChI | InChI=1S/C18H38N6O.2ClH/c1-6-24(5,7-2)14-13-22-17(25)18(4,23-15(3)19)12-10-8-9-11-16(20)21;;/h6-14H2,1-5H3,(H5-,19,20,21,22,23,25);2*1H |
| InChIKey | SYBOSVWDSJIVDL-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 117.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.47 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|