C18H40ClN6O+ — CID 123237936
2-[[2-(diaminomethylideneamino)-8-imino-2-methylnonanoyl]amino]ethyl-diethyl-methylazanium;hydrochloride (PubChem CID 123237936) has the molecular formula C18H40ClN6O+ and a molecular weight of 392.01 g/mol. Its IUPAC name is 2-[[2-(diaminomethylideneamino)-8-imino-2-methylnonanoyl]amino]ethyl-diethyl-methylazanium;hydrochloride.
| Compound Name | 2-[[2-(diaminomethylideneamino)-8-imino-2-methylnonanoyl]amino]ethyl-diethyl-methylazanium;hydrochloride |
|---|---|
| PubChem CID | 123237936 |
| Molecular Formula | C18H40ClN6O+ |
| Molecular Weight | 392.01 g/mol |
| Exact Mass | 391.29 |
| IUPAC Name | 2-[[2-(diaminomethylideneamino)-8-imino-2-methylnonanoyl]amino]ethyl-diethyl-methylazanium;hydrochloride |
| SMILES | Cl.[H]/N=C(\C)CCCCCC(C)(N=C(N)N)C(=O)NCC[N+](C)(CC)CC |
| InChI | InChI=1S/C18H38N6O.ClH/c1-6-24(5,7-2)14-13-22-16(25)18(4,23-17(20)21)12-10-8-9-11-15(3)19;/h19H,6-14H2,1-5H3,(H4-,20,21,22,23,25);1H/p+1/b19-15+; |
| InChIKey | CBYRGVPLHGOTJF-QTCZRQAZSA-O |
| XLogP | 2.03 |
| TPSA | 117.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.01 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|