About N-(2-iminohept-6-en-3-yl)-N'-methylethanimidamide
N-(2-iminohept-6-en-3-yl)-N'-methylethanimidamide (PubChem CID 123161639) has the molecular formula C10H19N3
and a molecular weight of 181.28 g/mol. Its IUPAC name is N-(2-iminohept-6-en-3-yl)-N'-methylethanimidamide.
Molecular Properties
| Compound Name | N-(2-iminohept-6-en-3-yl)-N'-methylethanimidamide |
| PubChem CID | 123161639 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | N-(2-iminohept-6-en-3-yl)-N'-methylethanimidamide |
| SMILES | [H]/N=C(\C)C(CCC=C)N/C(C)=N/C |
| InChI | InChI=1S/C10H19N3/c1-5-6-7-10(8(2)11)13-9(3)12-4/h5,10-11H,1,6-7H2,2-4H3,(H,12,13)/b11-8+ |
| InChIKey | VDOXCCBHEKODOG-DHZHZOJOSA-N |
| XLogP | 2.00 |
| TPSA | 48.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(2-iminohept-6-en-3-yl)-N'-methylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-iminohept-6-en-3-yl)-N'-methylethanimidamide?
The IUPAC name of N-(2-iminohept-6-en-3-yl)-N'-methylethanimidamide (CID 123161639) is N-(2-iminohept-6-en-3-yl)-N'-methylethanimidamide.
What is the SMILES notation for N-(2-iminohept-6-en-3-yl)-N'-methylethanimidamide?
The canonical SMILES for N-(2-iminohept-6-en-3-yl)-N'-methylethanimidamide is [H]/N=C(\C)C(CCC=C)N/C(C)=N/C.
What is the InChIKey of N-(2-iminohept-6-en-3-yl)-N'-methylethanimidamide?
The InChIKey is VDOXCCBHEKODOG-DHZHZOJOSA-N. The full InChI is InChI=1S/C10H19N3/c1-5-6-7-10(8(2)11)13-9(3)12-4/h5,10-11H,1,6-7H2,2-4H3,(H,12,13)/b11-8+.
What are the key properties of N-(2-iminohept-6-en-3-yl)-N'-methylethanimidamide?
N-(2-iminohept-6-en-3-yl)-N'-methylethanimidamide has a molecular weight of 181.28 g/mol, XLogP of 2.00, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-iminohept-6-en-3-yl)-N'-methylethanimidamide is sourced from PubChem (CID 123161639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).