About N-butan-2-yl-N'-methylbut-3-enimidamide
N-butan-2-yl-N'-methylbut-3-enimidamide (PubChem CID 155129645) has the molecular formula C9H18N2
and a molecular weight of 154.26 g/mol. Its IUPAC name is N-butan-2-yl-N'-methylbut-3-enimidamide.
Molecular Properties
| Compound Name | N-butan-2-yl-N'-methylbut-3-enimidamide |
| PubChem CID | 155129645 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | N-butan-2-yl-N'-methylbut-3-enimidamide |
| SMILES | C=CC/C(=N\C)NC(C)CC |
| InChI | InChI=1S/C9H18N2/c1-5-7-9(10-4)11-8(3)6-2/h5,8H,1,6-7H2,2-4H3,(H,10,11) |
| InChIKey | XZDKEXPBYWHAAL-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-butan-2-yl-N'-methylbut-3-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butan-2-yl-N'-methylbut-3-enimidamide?
The IUPAC name of N-butan-2-yl-N'-methylbut-3-enimidamide (CID 155129645) is N-butan-2-yl-N'-methylbut-3-enimidamide.
What is the SMILES notation for N-butan-2-yl-N'-methylbut-3-enimidamide?
The canonical SMILES for N-butan-2-yl-N'-methylbut-3-enimidamide is C=CC/C(=N\C)NC(C)CC.
What is the InChIKey of N-butan-2-yl-N'-methylbut-3-enimidamide?
The InChIKey is XZDKEXPBYWHAAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2/c1-5-7-9(10-4)11-8(3)6-2/h5,8H,1,6-7H2,2-4H3,(H,10,11).
What are the key properties of N-butan-2-yl-N'-methylbut-3-enimidamide?
N-butan-2-yl-N'-methylbut-3-enimidamide has a molecular weight of 154.26 g/mol, XLogP of 1.98, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-butan-2-yl-N'-methylbut-3-enimidamide is sourced from PubChem (CID 155129645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).