C42H52N2O4S — CID 123162089
5-[[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]methyl]-4-hydroxy-3-tricosa-5,8,11,14,17,20-hexaenoyl-1,3-thiazol-2-one (PubChem CID 123162089) has the molecular formula C42H52N2O4S and a molecular weight of 680.96 g/mol. Its IUPAC name is 5-[[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]methyl]-4-hydroxy-3-tricosa-5,8,11,14,17,20-hexaenoyl-1,3-thiazol-2-one.
| Compound Name | 5-[[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]methyl]-4-hydroxy-3-tricosa-5,8,11,14,17,20-hexaenoyl-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 123162089 |
| Molecular Formula | C42H52N2O4S |
| Molecular Weight | 680.96 g/mol |
| Exact Mass | 680.36 |
| IUPAC Name | 5-[[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]methyl]-4-hydroxy-3-tricosa-5,8,11,14,17,20-hexaenoyl-1,3-thiazol-2-one |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCC=CCCCC(=O)n1c(O)c(Cc2ccc(OCCc3ccc(CC)cn3)cc2)sc1=O |
| InChI | InChI=1S/C42H52N2O4S/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-40(45)44-41(46)39(49-42(44)47)33-36-26-29-38(30-27-36)48-32-31-37-28-25-35(4-2)34-43-37/h5-6,8-9,11-12,14-15,17-18,20-21,25-30,34,46H,3-4,7,10,13,16,19,22-24,31-33H2,1-2H3 |
| InChIKey | WVBOYXVXESNYNM-UHFFFAOYSA-N |
| XLogP | 10.29 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.96 |
| LogP ≤ 5 | 10.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|