C15H27N3 — CID 123162362
6-(4-cyclopropylpiperazin-1-yl)-N,N-dimethylhexa-2,4-dien-3-amine (PubChem CID 123162362) has the molecular formula C15H27N3 and a molecular weight of 249.40 g/mol. Its IUPAC name is 6-(4-cyclopropylpiperazin-1-yl)-N,N-dimethylhexa-2,4-dien-3-amine.
| Compound Name | 6-(4-cyclopropylpiperazin-1-yl)-N,N-dimethylhexa-2,4-dien-3-amine |
|---|---|
| PubChem CID | 123162362 |
| Molecular Formula | C15H27N3 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.22 |
| IUPAC Name | 6-(4-cyclopropylpiperazin-1-yl)-N,N-dimethylhexa-2,4-dien-3-amine |
| SMILES | CC=C(C=CCN1CCN(C2CC2)CC1)N(C)C |
| InChI | InChI=1S/C15H27N3/c1-4-14(16(2)3)6-5-9-17-10-12-18(13-11-17)15-7-8-15/h4-6,15H,7-13H2,1-3H3 |
| InChIKey | RFUNSBBUCWRCQZ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|