C15H23NO — CID 123162383
N,N-dimethyl-5-phenylmethoxyhex-5-en-1-amine (PubChem CID 123162383) has the molecular formula C15H23NO and a molecular weight of 233.35 g/mol. Its IUPAC name is N,N-dimethyl-5-phenylmethoxyhex-5-en-1-amine.
| Compound Name | N,N-dimethyl-5-phenylmethoxyhex-5-en-1-amine |
|---|---|
| PubChem CID | 123162383 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | N,N-dimethyl-5-phenylmethoxyhex-5-en-1-amine |
| SMILES | C=C(CCCCN(C)C)OCc1ccccc1 |
| InChI | InChI=1S/C15H23NO/c1-14(9-7-8-12-16(2)3)17-13-15-10-5-4-6-11-15/h4-6,10-11H,1,7-9,12-13H2,2-3H3 |
| InChIKey | HBPSHRBJBSWZMN-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|