C25H27N7O3 — CID 123163217
7-amino-1-(2,6-dimethyloxan-4-yl)-4,8-bis(1-methylpyrazol-4-yl)-[1]benzofuro[3,2-d]pyrimidin-2-one (PubChem CID 123163217) has the molecular formula C25H27N7O3 and a molecular weight of 473.54 g/mol. Its IUPAC name is 7-amino-1-(2,6-dimethyloxan-4-yl)-4,8-bis(1-methylpyrazol-4-yl)-[1]benzofuro[3,2-d]pyrimidin-2-one.
| Compound Name | 7-amino-1-(2,6-dimethyloxan-4-yl)-4,8-bis(1-methylpyrazol-4-yl)-[1]benzofuro[3,2-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 123163217 |
| Molecular Formula | C25H27N7O3 |
| Molecular Weight | 473.54 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | 7-amino-1-(2,6-dimethyloxan-4-yl)-4,8-bis(1-methylpyrazol-4-yl)-[1]benzofuro[3,2-d]pyrimidin-2-one |
| SMILES | CC1CC(n2c(=O)nc(-c3cnn(C)c3)c3oc4cc(N)c(-c5cnn(C)c5)cc4c32)CC(C)O1 |
| InChI | InChI=1S/C25H27N7O3/c1-13-5-17(6-14(2)34-13)32-23-19-7-18(15-9-27-30(3)11-15)20(26)8-21(19)35-24(23)22(29-25(32)33)16-10-28-31(4)12-16/h7-14,17H,5-6,26H2,1-4H3 |
| InChIKey | PWSZHCMUYUGTQG-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 118.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.54 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|