C26H28ClF2N5O4 — CID 123164684
N-[4-(3-chloro-4-fluoroanilino)-7-ethoxyquinazolin-6-yl]-2-fluoro-4-[3-(2-hydroxyethoxy)pyrrolidin-1-yl]but-2-enamide (PubChem CID 123164684) has the molecular formula C26H28ClF2N5O4 and a molecular weight of 547.99 g/mol. Its IUPAC name is N-[4-(3-chloro-4-fluoroanilino)-7-ethoxyquinazolin-6-yl]-2-fluoro-4-[3-(2-hydroxyethoxy)pyrrolidin-1-yl]but-2-enamide.
| Compound Name | N-[4-(3-chloro-4-fluoroanilino)-7-ethoxyquinazolin-6-yl]-2-fluoro-4-[3-(2-hydroxyethoxy)pyrrolidin-1-yl]but-2-enamide |
|---|---|
| PubChem CID | 123164684 |
| Molecular Formula | C26H28ClF2N5O4 |
| Molecular Weight | 547.99 g/mol |
| Exact Mass | 547.18 |
| IUPAC Name | N-[4-(3-chloro-4-fluoroanilino)-7-ethoxyquinazolin-6-yl]-2-fluoro-4-[3-(2-hydroxyethoxy)pyrrolidin-1-yl]but-2-enamide |
| SMILES | CCOc1cc2ncnc(Nc3ccc(F)c(Cl)c3)c2cc1NC(=O)C(F)=CCN1CCC(OCCO)C1 |
| InChI | InChI=1S/C26H28ClF2N5O4/c1-2-37-24-13-22-18(25(31-15-30-22)32-16-3-4-20(28)19(27)11-16)12-23(24)33-26(36)21(29)6-8-34-7-5-17(14-34)38-10-9-35/h3-4,6,11-13,15,17,35H,2,5,7-10,14H2,1H3,(H,33,36)(H,30,31,32) |
| InChIKey | CTLUZCQOOBEYAU-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 108.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.99 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|