C32H41N5O4Si — CID 123165019
4-[7-[N-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-3,5-dimethoxyanilino]quinoxalin-2-yl]-N-methylpyridine-2-carboxamide (PubChem CID 123165019) has the molecular formula C32H41N5O4Si and a molecular weight of 587.80 g/mol. Its IUPAC name is 4-[7-[N-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-3,5-dimethoxyanilino]quinoxalin-2-yl]-N-methylpyridine-2-carboxamide.
| Compound Name | 4-[7-[N-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-3,5-dimethoxyanilino]quinoxalin-2-yl]-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 123165019 |
| Molecular Formula | C32H41N5O4Si |
| Molecular Weight | 587.80 g/mol |
| Exact Mass | 587.29 |
| IUPAC Name | 4-[7-[N-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-3,5-dimethoxyanilino]quinoxalin-2-yl]-N-methylpyridine-2-carboxamide |
| SMILES | CNC(=O)c1cc(-c2cnc3ccc(N(CCCO[Si](C)(C)C(C)(C)C)c4cc(OC)cc(OC)c4)cc3n2)ccn1 |
| InChI | InChI=1S/C32H41N5O4Si/c1-32(2,3)42(7,8)41-15-9-14-37(24-17-25(39-5)20-26(18-24)40-6)23-10-11-27-28(19-23)36-30(21-35-27)22-12-13-34-29(16-22)31(38)33-4/h10-13,16-21H,9,14-15H2,1-8H3,(H,33,38) |
| InChIKey | IARAXDHHMKMVOQ-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 98.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.80 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|