C41H58N6O6Si — CID 123622665
tert-butyl N-[5-[[4-[7-[N-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-3,5-dimethoxyanilino]quinoxalin-2-yl]pyridine-2-carbonyl]amino]pentyl]carbamate (PubChem CID 123622665) has the molecular formula C41H58N6O6Si and a molecular weight of 759.04 g/mol. Its IUPAC name is tert-butyl N-[5-[[4-[7-[N-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-3,5-dimethoxyanilino]quinoxalin-2-yl]pyridine-2-carbonyl]amino]pentyl]carbamate.
| Compound Name | tert-butyl N-[5-[[4-[7-[N-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-3,5-dimethoxyanilino]quinoxalin-2-yl]pyridine-2-carbonyl]amino]pentyl]carbamate |
|---|---|
| PubChem CID | 123622665 |
| Molecular Formula | C41H58N6O6Si |
| Molecular Weight | 759.04 g/mol |
| Exact Mass | 758.42 |
| IUPAC Name | tert-butyl N-[5-[[4-[7-[N-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-3,5-dimethoxyanilino]quinoxalin-2-yl]pyridine-2-carbonyl]amino]pentyl]carbamate |
| SMILES | COc1cc(OC)cc(N(CCCO[Si](C)(C)C(C)(C)C)c2ccc3ncc(-c4ccnc(C(=O)NCCCCCNC(=O)OC(C)(C)C)c4)nc3c2)c1 |
| InChI | InChI=1S/C41H58N6O6Si/c1-40(2,3)53-39(49)44-19-13-11-12-18-43-38(48)36-23-29(17-20-42-36)37-28-45-34-16-15-30(26-35(34)46-37)47(21-14-22-52-54(9,10)41(4,5)6)31-24-32(50-7)27-33(25-31)51-8/h15-17,20,23-28H,11-14,18-19,21-22H2,1-10H3,(H,43,48)(H,44,49) |
| InChIKey | NPORUJQUIRTHJN-UHFFFAOYSA-N |
| XLogP | 8.68 |
| TPSA | 137.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.04 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|