C29H56N2 — CID 123165317
12-ethyl-8-imino-N,N,6,7,9,11,15,16-octamethyl-5-methylideneoctadec-6-en-2-amine (PubChem CID 123165317) has the molecular formula C29H56N2 and a molecular weight of 432.78 g/mol. Its IUPAC name is 12-ethyl-8-imino-N,N,6,7,9,11,15,16-octamethyl-5-methylideneoctadec-6-en-2-amine.
| Compound Name | 12-ethyl-8-imino-N,N,6,7,9,11,15,16-octamethyl-5-methylideneoctadec-6-en-2-amine |
|---|---|
| PubChem CID | 123165317 |
| Molecular Formula | C29H56N2 |
| Molecular Weight | 432.78 g/mol |
| Exact Mass | 432.44 |
| IUPAC Name | 12-ethyl-8-imino-N,N,6,7,9,11,15,16-octamethyl-5-methylideneoctadec-6-en-2-amine |
| SMILES | [H]/N=C(/C(C)=C(C)C(=C)CCC(C)N(C)C)C(C)CC(C)C(CC)CCC(C)C(C)CC |
| InChI | InChI=1S/C29H56N2/c1-13-20(3)21(4)16-18-28(14-2)23(6)19-24(7)29(30)27(10)26(9)22(5)15-17-25(8)31(11)12/h20-21,23-25,28,30H,5,13-19H2,1-4,6-12H3/b27-26?,30-29+ |
| InChIKey | JHIJOJWNMXYWKI-IJLLQHCHSA-N |
| XLogP | 8.78 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.78 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|