C23H38N2 — CID 123979813
(7E)-6-imino-N-methyl-7-(3-methylbut-3-en-2-yl)-3,5-dimethylidene-N-propyldodeca-7,10-dien-1-amine (PubChem CID 123979813) has the molecular formula C23H38N2 and a molecular weight of 342.57 g/mol. Its IUPAC name is (7E)-6-imino-N-methyl-7-(3-methylbut-3-en-2-yl)-3,5-dimethylidene-N-propyldodeca-7,10-dien-1-amine.
| Compound Name | (7E)-6-imino-N-methyl-7-(3-methylbut-3-en-2-yl)-3,5-dimethylidene-N-propyldodeca-7,10-dien-1-amine |
|---|---|
| PubChem CID | 123979813 |
| Molecular Formula | C23H38N2 |
| Molecular Weight | 342.57 g/mol |
| Exact Mass | 342.30 |
| IUPAC Name | (7E)-6-imino-N-methyl-7-(3-methylbut-3-en-2-yl)-3,5-dimethylidene-N-propyldodeca-7,10-dien-1-amine |
| SMILES | [H]/N=C(C(=C)CC(=C)CCN(C)CCC)/C(=C/CC=CC)C(C)C(=C)C |
| InChI | InChI=1S/C23H38N2/c1-9-11-12-13-22(21(7)18(3)4)23(24)20(6)17-19(5)14-16-25(8)15-10-2/h9,11,13,21,24H,3,5-6,10,12,14-17H2,1-2,4,7-8H3/b11-9?,22-13+,24-23+ |
| InChIKey | GOUDCOAMIFRFEP-UGLMBFNUSA-N |
| XLogP | 6.35 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.57 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|