C24H36N2 — CID 123574938
1-cycloocta-1,4-dien-1-yl-6-(3,4-dimethyl-4H-pyridin-1-yl)-3,4-dimethyl-2-methylidenehexan-1-imine (PubChem CID 123574938) has the molecular formula C24H36N2 and a molecular weight of 352.57 g/mol. Its IUPAC name is 1-cycloocta-1,4-dien-1-yl-6-(3,4-dimethyl-4H-pyridin-1-yl)-3,4-dimethyl-2-methylidenehexan-1-imine.
| Compound Name | 1-cycloocta-1,4-dien-1-yl-6-(3,4-dimethyl-4H-pyridin-1-yl)-3,4-dimethyl-2-methylidenehexan-1-imine |
|---|---|
| PubChem CID | 123574938 |
| Molecular Formula | C24H36N2 |
| Molecular Weight | 352.57 g/mol |
| Exact Mass | 352.29 |
| IUPAC Name | 1-cycloocta-1,4-dien-1-yl-6-(3,4-dimethyl-4H-pyridin-1-yl)-3,4-dimethyl-2-methylidenehexan-1-imine |
| SMILES | [H]/N=C(\C(=C)C(C)C(C)CCN1C=CC(C)C(C)=C1)C1=CCC=CCCC1 |
| InChI | InChI=1S/C24H36N2/c1-18-13-15-26(17-20(18)3)16-14-19(2)21(4)22(5)24(25)23-11-9-7-6-8-10-12-23/h6-7,11,13,15,17-19,21,25H,5,8-10,12,14,16H2,1-4H3/b7-6?,23-11?,25-24+ |
| InChIKey | IYNHCBIZUJVVGE-MXNXCYJQSA-N |
| XLogP | 6.65 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.57 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|