C13H22N2 — CID 155720872
1-[4-(N-ethenyl-C-ethylcarbonimidoyl)cyclohex-3-en-1-yl]-N-methylmethanamine (PubChem CID 155720872) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is 1-[4-(N-ethenyl-C-ethylcarbonimidoyl)cyclohex-3-en-1-yl]-N-methylmethanamine.
| Compound Name | 1-[4-(N-ethenyl-C-ethylcarbonimidoyl)cyclohex-3-en-1-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 155720872 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | 1-[4-(N-ethenyl-C-ethylcarbonimidoyl)cyclohex-3-en-1-yl]-N-methylmethanamine |
| SMILES | C=C/N=C(\CC)C1=CCC(CNC)CC1 |
| InChI | InChI=1S/C13H22N2/c1-4-13(15-5-2)12-8-6-11(7-9-12)10-14-3/h5,8,11,14H,2,4,6-7,9-10H2,1,3H3/b15-13+ |
| InChIKey | CVZADFDKVGGEFM-FYWRMAATSA-N |
| XLogP | 2.93 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|