C28H46N2 — CID 123332239
(7Z)-6-imino-N-methyl-3,5-dimethylidene-7-(4-methylpent-4-en-2-yl)-8-(2-methylprop-2-enyl)-N-propyldodeca-7,10-dien-1-amine (PubChem CID 123332239) has the molecular formula C28H46N2 and a molecular weight of 410.69 g/mol. Its IUPAC name is (7Z)-6-imino-N-methyl-3,5-dimethylidene-7-(4-methylpent-4-en-2-yl)-8-(2-methylprop-2-enyl)-N-propyldodeca-7,10-dien-1-amine.
| Compound Name | (7Z)-6-imino-N-methyl-3,5-dimethylidene-7-(4-methylpent-4-en-2-yl)-8-(2-methylprop-2-enyl)-N-propyldodeca-7,10-dien-1-amine |
|---|---|
| PubChem CID | 123332239 |
| Molecular Formula | C28H46N2 |
| Molecular Weight | 410.69 g/mol |
| Exact Mass | 410.37 |
| IUPAC Name | (7Z)-6-imino-N-methyl-3,5-dimethylidene-7-(4-methylpent-4-en-2-yl)-8-(2-methylprop-2-enyl)-N-propyldodeca-7,10-dien-1-amine |
| SMILES | [H]/N=C(C(=C)CC(=C)CCN(C)CCC)/C(=C(/CC=CC)CC(=C)C)C(C)CC(=C)C |
| InChI | InChI=1S/C28H46N2/c1-11-13-14-26(19-22(5)6)27(24(8)18-21(3)4)28(29)25(9)20-23(7)15-17-30(10)16-12-2/h11,13,24,29H,3,5,7,9,12,14-20H2,1-2,4,6,8,10H3/b13-11?,27-26-,29-28+ |
| InChIKey | TYVCGCFMOBASTD-ABXREDOSSA-N |
| XLogP | 8.07 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.69 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|