C24H41N3 — CID 123916865
1-cycloocta-1,4-dien-1-yl-3,4-dimethyl-2-methylidene-6-(4-propylpiperazin-1-yl)hexan-1-imine (PubChem CID 123916865) has the molecular formula C24H41N3 and a molecular weight of 371.61 g/mol. Its IUPAC name is 1-cycloocta-1,4-dien-1-yl-3,4-dimethyl-2-methylidene-6-(4-propylpiperazin-1-yl)hexan-1-imine.
| Compound Name | 1-cycloocta-1,4-dien-1-yl-3,4-dimethyl-2-methylidene-6-(4-propylpiperazin-1-yl)hexan-1-imine |
|---|---|
| PubChem CID | 123916865 |
| Molecular Formula | C24H41N3 |
| Molecular Weight | 371.61 g/mol |
| Exact Mass | 371.33 |
| IUPAC Name | 1-cycloocta-1,4-dien-1-yl-3,4-dimethyl-2-methylidene-6-(4-propylpiperazin-1-yl)hexan-1-imine |
| SMILES | [H]/N=C(\C(=C)C(C)C(C)CCN1CCN(CCC)CC1)C1=CCC=CCCC1 |
| InChI | InChI=1S/C24H41N3/c1-5-14-26-16-18-27(19-17-26)15-13-20(2)21(3)22(4)24(25)23-11-9-7-6-8-10-12-23/h6-7,11,20-21,25H,4-5,8-10,12-19H2,1-3H3/b7-6?,23-11?,25-24+ |
| InChIKey | YQIRSHPERGWZBP-MXNXCYJQSA-N |
| XLogP | 5.31 |
| TPSA | 30.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.61 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|