C21H36N2 — CID 123645917
5-(cycloocta-1,4-diene-1-carboximidoyl)-N,3,4-trimethyl-N-propylhex-5-en-1-amine (PubChem CID 123645917) has the molecular formula C21H36N2 and a molecular weight of 316.53 g/mol. Its IUPAC name is 5-(cycloocta-1,4-diene-1-carboximidoyl)-N,3,4-trimethyl-N-propylhex-5-en-1-amine.
| Compound Name | 5-(cycloocta-1,4-diene-1-carboximidoyl)-N,3,4-trimethyl-N-propylhex-5-en-1-amine |
|---|---|
| PubChem CID | 123645917 |
| Molecular Formula | C21H36N2 |
| Molecular Weight | 316.53 g/mol |
| Exact Mass | 316.29 |
| IUPAC Name | 5-(cycloocta-1,4-diene-1-carboximidoyl)-N,3,4-trimethyl-N-propylhex-5-en-1-amine |
| SMILES | [H]/N=C(\C(=C)C(C)C(C)CCN(C)CCC)C1=CCC=CCCC1 |
| InChI | InChI=1S/C21H36N2/c1-6-15-23(5)16-14-17(2)18(3)19(4)21(22)20-12-10-8-7-9-11-13-20/h7-8,12,17-18,22H,4,6,9-11,13-16H2,1-3,5H3/b8-7?,20-12?,22-21+ |
| InChIKey | AVMYHCPPPYMXFM-GHQKEATHSA-N |
| XLogP | 5.62 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.53 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|