C16H28N2 — CID 123594107
2-ethyl-3-(4-iminocyclohepta-2,5-dien-1-yl)-N,N-dimethylpentan-1-amine (PubChem CID 123594107) has the molecular formula C16H28N2 and a molecular weight of 248.41 g/mol. Its IUPAC name is 2-ethyl-3-(4-iminocyclohepta-2,5-dien-1-yl)-N,N-dimethylpentan-1-amine.
| Compound Name | 2-ethyl-3-(4-iminocyclohepta-2,5-dien-1-yl)-N,N-dimethylpentan-1-amine |
|---|---|
| PubChem CID | 123594107 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | 2-ethyl-3-(4-iminocyclohepta-2,5-dien-1-yl)-N,N-dimethylpentan-1-amine |
| SMILES | [H]/N=C1\C=CCC(C(CC)C(CC)CN(C)C)C=C1 |
| InChI | InChI=1S/C16H28N2/c1-5-13(12-18(3)4)16(6-2)14-8-7-9-15(17)11-10-14/h7,9-11,13-14,16-17H,5-6,8,12H2,1-4H3/b17-15+ |
| InChIKey | XPUNVTPEYRWDDM-BMRADRMJSA-N |
| XLogP | 3.75 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|