C16H32N2 — CID 142102799
2-ethyl-N-methyl-N-[(Z)-2-methyliminohex-3-enyl]hexan-1-amine (PubChem CID 142102799) has the molecular formula C16H32N2 and a molecular weight of 252.45 g/mol. Its IUPAC name is 2-ethyl-N-methyl-N-[(Z)-2-methyliminohex-3-enyl]hexan-1-amine.
| Compound Name | 2-ethyl-N-methyl-N-[(Z)-2-methyliminohex-3-enyl]hexan-1-amine |
|---|---|
| PubChem CID | 142102799 |
| Molecular Formula | C16H32N2 |
| Molecular Weight | 252.45 g/mol |
| Exact Mass | 252.26 |
| IUPAC Name | 2-ethyl-N-methyl-N-[(Z)-2-methyliminohex-3-enyl]hexan-1-amine |
| SMILES | CC/C=C\C(CN(C)CC(CC)CCCC)=N/C |
| InChI | InChI=1S/C16H32N2/c1-6-9-11-15(8-3)13-18(5)14-16(17-4)12-10-7-2/h10,12,15H,6-9,11,13-14H2,1-5H3/b12-10-,17-16+ |
| InChIKey | VLFBGJZAJKPCFV-OLRLHGROSA-N |
| XLogP | 4.17 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.45 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|