C20H40N2 — CID 144654738
ethane;N-[(Z)-3-ethenyliminohex-4-en-2-yl]-N,4-dimethylcyclohexan-1-amine (PubChem CID 144654738) has the molecular formula C20H40N2 and a molecular weight of 308.55 g/mol. Its IUPAC name is ethane;N-[(Z)-3-ethenyliminohex-4-en-2-yl]-N,4-dimethylcyclohexan-1-amine.
| Compound Name | ethane;N-[(Z)-3-ethenyliminohex-4-en-2-yl]-N,4-dimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 144654738 |
| Molecular Formula | C20H40N2 |
| Molecular Weight | 308.55 g/mol |
| Exact Mass | 308.32 |
| IUPAC Name | ethane;N-[(Z)-3-ethenyliminohex-4-en-2-yl]-N,4-dimethylcyclohexan-1-amine |
| SMILES | C=C/N=C(\C=C/C)C(C)N(C)C1CCC(C)CC1.CC.CC |
| InChI | InChI=1S/C16H28N2.2C2H6/c1-6-8-16(17-7-2)14(4)18(5)15-11-9-13(3)10-12-15;2*1-2/h6-8,13-15H,2,9-12H2,1,3-5H3;2*1-2H3/b8-6-,17-16+;; |
| InChIKey | UATMDYJEIVLSBX-DXNGUAPTSA-N |
| XLogP | 6.10 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.55 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|