C22H36N2 — CID 91289694
N-(1-cyclohexylethyl)-N,2,12-trimethyl-3-azabicyclo[5.5.0]dodeca-1(7),2,9-trien-12-amine (PubChem CID 91289694) has the molecular formula C22H36N2 and a molecular weight of 328.54 g/mol. Its IUPAC name is N-(1-cyclohexylethyl)-N,2,12-trimethyl-3-azabicyclo[5.5.0]dodeca-1(7),2,9-trien-12-amine.
| Compound Name | N-(1-cyclohexylethyl)-N,2,12-trimethyl-3-azabicyclo[5.5.0]dodeca-1(7),2,9-trien-12-amine |
|---|---|
| PubChem CID | 91289694 |
| Molecular Formula | C22H36N2 |
| Molecular Weight | 328.54 g/mol |
| Exact Mass | 328.29 |
| IUPAC Name | N-(1-cyclohexylethyl)-N,2,12-trimethyl-3-azabicyclo[5.5.0]dodeca-1(7),2,9-trien-12-amine |
| SMILES | CC1=NCCCC2=C1C(C)(N(C)C(C)C1CCCCC1)CC=CC2 |
| InChI | InChI=1S/C22H36N2/c1-17-21-20(14-10-16-23-17)13-8-9-15-22(21,3)24(4)18(2)19-11-6-5-7-12-19/h8-9,18-19H,5-7,10-16H2,1-4H3 |
| InChIKey | MWQJCTDBIQYDOI-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.54 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|