C20H34N2 — CID 144778791
4-ethyl-N-methyl-N-[1-(4-propan-2-yl-4H-azepin-7-yl)ethyl]cyclohexan-1-amine (PubChem CID 144778791) has the molecular formula C20H34N2 and a molecular weight of 302.51 g/mol. Its IUPAC name is 4-ethyl-N-methyl-N-[1-(4-propan-2-yl-4H-azepin-7-yl)ethyl]cyclohexan-1-amine.
| Compound Name | 4-ethyl-N-methyl-N-[1-(4-propan-2-yl-4H-azepin-7-yl)ethyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 144778791 |
| Molecular Formula | C20H34N2 |
| Molecular Weight | 302.51 g/mol |
| Exact Mass | 302.27 |
| IUPAC Name | 4-ethyl-N-methyl-N-[1-(4-propan-2-yl-4H-azepin-7-yl)ethyl]cyclohexan-1-amine |
| SMILES | CCC1CCC(N(C)C(C)C2=NC=CC(C(C)C)C=C2)CC1 |
| InChI | InChI=1S/C20H34N2/c1-6-17-7-10-19(11-8-17)22(5)16(4)20-12-9-18(15(2)3)13-14-21-20/h9,12-19H,6-8,10-11H2,1-5H3 |
| InChIKey | MHLQZUTVOKQGNY-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.51 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |