C22H37N3 — CID 123477319
1-cycloocta-1,4-dien-1-yl-3,4-dimethyl-2-methylidene-6-(4-methylpiperazin-1-yl)hexan-1-imine (PubChem CID 123477319) has the molecular formula C22H37N3 and a molecular weight of 343.56 g/mol. Its IUPAC name is 1-cycloocta-1,4-dien-1-yl-3,4-dimethyl-2-methylidene-6-(4-methylpiperazin-1-yl)hexan-1-imine.
| Compound Name | 1-cycloocta-1,4-dien-1-yl-3,4-dimethyl-2-methylidene-6-(4-methylpiperazin-1-yl)hexan-1-imine |
|---|---|
| PubChem CID | 123477319 |
| Molecular Formula | C22H37N3 |
| Molecular Weight | 343.56 g/mol |
| Exact Mass | 343.30 |
| IUPAC Name | 1-cycloocta-1,4-dien-1-yl-3,4-dimethyl-2-methylidene-6-(4-methylpiperazin-1-yl)hexan-1-imine |
| SMILES | [H]/N=C(\C(=C)C(C)C(C)CCN1CCN(C)CC1)C1=CCC=CCCC1 |
| InChI | InChI=1S/C22H37N3/c1-18(12-13-25-16-14-24(4)15-17-25)19(2)20(3)22(23)21-10-8-6-5-7-9-11-21/h5-6,10,18-19,23H,3,7-9,11-17H2,1-2,4H3/b6-5?,21-10?,23-22+ |
| InChIKey | FGTKBFXDKLOWJG-RGAJYPHOSA-N |
| XLogP | 4.53 |
| TPSA | 30.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.56 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|