C37H60N2 — CID 123244153
(1-tert-butyl-4-ethyl-4-methyl-2,3-dihydropyridin-5-yl)-[4-[1-(4-tert-butyl-5,8,8-trimethylcycloocten-1-yl)ethenyl]-6-methylcyclohexa-2,4-dien-1-yl]methanimine (PubChem CID 123244153) has the molecular formula C37H60N2 and a molecular weight of 532.90 g/mol. Its IUPAC name is (1-tert-butyl-4-ethyl-4-methyl-2,3-dihydropyridin-5-yl)-[4-[1-(4-tert-butyl-5,8,8-trimethylcycloocten-1-yl)ethenyl]-6-methylcyclohexa-2,4-dien-1-yl]methanimine.
| Compound Name | (1-tert-butyl-4-ethyl-4-methyl-2,3-dihydropyridin-5-yl)-[4-[1-(4-tert-butyl-5,8,8-trimethylcycloocten-1-yl)ethenyl]-6-methylcyclohexa-2,4-dien-1-yl]methanimine |
|---|---|
| PubChem CID | 123244153 |
| Molecular Formula | C37H60N2 |
| Molecular Weight | 532.90 g/mol |
| Exact Mass | 532.48 |
| IUPAC Name | (1-tert-butyl-4-ethyl-4-methyl-2,3-dihydropyridin-5-yl)-[4-[1-(4-tert-butyl-5,8,8-trimethylcycloocten-1-yl)ethenyl]-6-methylcyclohexa-2,4-dien-1-yl]methanimine |
| SMILES | [H]/N=C(\C1=CN(C(C)(C)C)CCC1(C)CC)C1C=CC(C(=C)C2=CCC(C(C)(C)C)C(C)CCC2(C)C)=CC1C |
| InChI | InChI=1S/C37H60N2/c1-14-37(13)21-22-39(35(8,9)10)24-32(37)33(38)29-16-15-28(23-26(29)3)27(4)31-18-17-30(34(5,6)7)25(2)19-20-36(31,11)12/h15-16,18,23-26,29-30,38H,4,14,17,19-22H2,1-3,5-13H3/b31-18?,38-33- |
| InChIKey | YGPXGHUWWNQGLU-WNLQXORPSA-N |
| XLogP | 10.55 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.90 |
| LogP ≤ 5 | 10.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|