C12H22N2O2S — CID 123167690
2-(dimethylamino)-6-propan-2-yl-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-4,5-diol (PubChem CID 123167690) has the molecular formula C12H22N2O2S and a molecular weight of 258.39 g/mol. Its IUPAC name is 2-(dimethylamino)-6-propan-2-yl-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-4,5-diol.
| Compound Name | 2-(dimethylamino)-6-propan-2-yl-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-4,5-diol |
|---|---|
| PubChem CID | 123167690 |
| Molecular Formula | C12H22N2O2S |
| Molecular Weight | 258.39 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 2-(dimethylamino)-6-propan-2-yl-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-4,5-diol |
| SMILES | CC(C)C1CC2SC(N(C)C)=NC2C(O)C1O |
| InChI | InChI=1S/C12H22N2O2S/c1-6(2)7-5-8-9(11(16)10(7)15)13-12(17-8)14(3)4/h6-11,15-16H,5H2,1-4H3 |
| InChIKey | GLZKQQVFCAUBKS-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 56.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.39 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |