C39H47N2O11S2+ — CID 123168257
[4-[[3-(3-carboxypropyl)-3-methyl-5-sulfo-1-(3-sulfopropyl)indol-2-ylidene]methyl]-3-methyl-2-phenylchromen-7-ylidene]-bis(2-methoxyethyl)azanium (PubChem CID 123168257) has the molecular formula C39H47N2O11S2+ and a molecular weight of 783.94 g/mol. Its IUPAC name is [4-[[3-(3-carboxypropyl)-3-methyl-5-sulfo-1-(3-sulfopropyl)indol-2-ylidene]methyl]-3-methyl-2-phenylchromen-7-ylidene]-bis(2-methoxyethyl)azanium.
| Compound Name | [4-[[3-(3-carboxypropyl)-3-methyl-5-sulfo-1-(3-sulfopropyl)indol-2-ylidene]methyl]-3-methyl-2-phenylchromen-7-ylidene]-bis(2-methoxyethyl)azanium |
|---|---|
| PubChem CID | 123168257 |
| Molecular Formula | C39H47N2O11S2+ |
| Molecular Weight | 783.94 g/mol |
| Exact Mass | 783.26 |
| IUPAC Name | [4-[[3-(3-carboxypropyl)-3-methyl-5-sulfo-1-(3-sulfopropyl)indol-2-ylidene]methyl]-3-methyl-2-phenylchromen-7-ylidene]-bis(2-methoxyethyl)azanium |
| SMILES | COCC[N+](CCOC)=c1ccc2c(C=C3N(CCCS(=O)(=O)O)c4ccc(S(=O)(=O)O)cc4C3(C)CCCC(=O)O)c(C)c(-c3ccccc3)oc-2c1 |
| InChI | InChI=1S/C39H46N2O11S2/c1-27-32(31-15-13-29(40(19-21-50-3)20-22-51-4)24-35(31)52-38(27)28-10-6-5-7-11-28)26-36-39(2,17-8-12-37(42)43)33-25-30(54(47,48)49)14-16-34(33)41(36)18-9-23-53(44,45)46/h5-7,10-11,13-16,24-26H,8-9,12,17-23H2,1-4H3,(H2-,42,43,44,45,46,47,48,49)/p+1 |
| InChIKey | ZLYJYHZLFJUGCI-UHFFFAOYSA-O |
| XLogP | 5.32 |
| TPSA | 183.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.94 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|