C41H49N2O11S2+ — CID 123406956
[4-[3-[3-(3-carboxypropyl)-3-methyl-5-sulfo-1-(3-sulfopropyl)indol-2-ylidene]prop-1-enyl]-3-methyl-2-phenylchromen-7-ylidene]-bis(2-methoxyethyl)azanium (PubChem CID 123406956) has the molecular formula C41H49N2O11S2+ and a molecular weight of 809.98 g/mol. Its IUPAC name is [4-[3-[3-(3-carboxypropyl)-3-methyl-5-sulfo-1-(3-sulfopropyl)indol-2-ylidene]prop-1-enyl]-3-methyl-2-phenylchromen-7-ylidene]-bis(2-methoxyethyl)azanium.
| Compound Name | [4-[3-[3-(3-carboxypropyl)-3-methyl-5-sulfo-1-(3-sulfopropyl)indol-2-ylidene]prop-1-enyl]-3-methyl-2-phenylchromen-7-ylidene]-bis(2-methoxyethyl)azanium |
|---|---|
| PubChem CID | 123406956 |
| Molecular Formula | C41H49N2O11S2+ |
| Molecular Weight | 809.98 g/mol |
| Exact Mass | 809.28 |
| IUPAC Name | [4-[3-[3-(3-carboxypropyl)-3-methyl-5-sulfo-1-(3-sulfopropyl)indol-2-ylidene]prop-1-enyl]-3-methyl-2-phenylchromen-7-ylidene]-bis(2-methoxyethyl)azanium |
| SMILES | COCC[N+](CCOC)=c1ccc2c(C=CC=C3N(CCCS(=O)(=O)O)c4ccc(S(=O)(=O)O)cc4C3(C)CCCC(=O)O)c(C)c(-c3ccccc3)oc-2c1 |
| InChI | InChI=1S/C41H48N2O11S2/c1-29-33(34-18-16-31(42(22-24-52-3)23-25-53-4)27-37(34)54-40(29)30-11-6-5-7-12-30)13-8-14-38-41(2,20-9-15-39(44)45)35-28-32(56(49,50)51)17-19-36(35)43(38)21-10-26-55(46,47)48/h5-8,11-14,16-19,27-28H,9-10,15,20-26H2,1-4H3,(H2-,44,45,46,47,48,49,50,51)/p+1 |
| InChIKey | JOEUVEVXSPDAOF-UHFFFAOYSA-O |
| XLogP | 5.88 |
| TPSA | 183.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.98 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|