C32H36N4O4S — CID 123169068
6-[3-[6-hydroxyhexyl(methyl)carbamoyl]phenyl]sulfanyl-4-(3-methoxyanilino)-8-methylquinoline-3-carboxamide (PubChem CID 123169068) has the molecular formula C32H36N4O4S and a molecular weight of 572.73 g/mol. Its IUPAC name is 6-[3-[6-hydroxyhexyl(methyl)carbamoyl]phenyl]sulfanyl-4-(3-methoxyanilino)-8-methylquinoline-3-carboxamide.
| Compound Name | 6-[3-[6-hydroxyhexyl(methyl)carbamoyl]phenyl]sulfanyl-4-(3-methoxyanilino)-8-methylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 123169068 |
| Molecular Formula | C32H36N4O4S |
| Molecular Weight | 572.73 g/mol |
| Exact Mass | 572.25 |
| IUPAC Name | 6-[3-[6-hydroxyhexyl(methyl)carbamoyl]phenyl]sulfanyl-4-(3-methoxyanilino)-8-methylquinoline-3-carboxamide |
| SMILES | COc1cccc(Nc2c(C(N)=O)cnc3c(C)cc(Sc4cccc(C(=O)N(C)CCCCCCO)c4)cc23)c1 |
| InChI | InChI=1S/C32H36N4O4S/c1-21-16-26(41-25-13-8-10-22(17-25)32(39)36(2)14-6-4-5-7-15-37)19-27-29(21)34-20-28(31(33)38)30(27)35-23-11-9-12-24(18-23)40-3/h8-13,16-20,37H,4-7,14-15H2,1-3H3,(H2,33,38)(H,34,35) |
| InChIKey | AVRVPERGWCEUSJ-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 117.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.73 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|