About [2-fluoro-3-(trifluoromethyl)phenyl]-dimethyl-sulfanyl-λ4-sulfane
[2-fluoro-3-(trifluoromethyl)phenyl]-dimethyl-sulfanyl-λ4-sulfane (PubChem CID 123175076) has the molecular formula C9H10F4S2
and a molecular weight of 258.31 g/mol. Its IUPAC name is [2-fluoro-3-(trifluoromethyl)phenyl]-dimethyl-sulfanyl-λ4-sulfane.
Molecular Properties
| Compound Name | [2-fluoro-3-(trifluoromethyl)phenyl]-dimethyl-sulfanyl-λ4-sulfane |
| PubChem CID | 123175076 |
| Molecular Formula | C9H10F4S2 |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.02 |
| IUPAC Name | [2-fluoro-3-(trifluoromethyl)phenyl]-dimethyl-sulfanyl-λ4-sulfane |
| SMILES | CS(C)(S)c1cccc(C(F)(F)F)c1F |
| InChI | InChI=1S/C9H10F4S2/c1-15(2,14)7-5-3-4-6(8(7)10)9(11,12)13/h3-5,14H,1-2H3 |
| InChIKey | PPVPBZDVGAZNMW-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze [2-fluoro-3-(trifluoromethyl)phenyl]-dimethyl-sulfanyl-λ4-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-fluoro-3-(trifluoromethyl)phenyl]-dimethyl-sulfanyl-λ4-sulfane?
The IUPAC name of [2-fluoro-3-(trifluoromethyl)phenyl]-dimethyl-sulfanyl-λ4-sulfane (CID 123175076) is [2-fluoro-3-(trifluoromethyl)phenyl]-dimethyl-sulfanyl-λ4-sulfane.
What is the SMILES notation for [2-fluoro-3-(trifluoromethyl)phenyl]-dimethyl-sulfanyl-λ4-sulfane?
The canonical SMILES for [2-fluoro-3-(trifluoromethyl)phenyl]-dimethyl-sulfanyl-λ4-sulfane is CS(C)(S)c1cccc(C(F)(F)F)c1F.
What is the InChIKey of [2-fluoro-3-(trifluoromethyl)phenyl]-dimethyl-sulfanyl-λ4-sulfane?
The InChIKey is PPVPBZDVGAZNMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10F4S2/c1-15(2,14)7-5-3-4-6(8(7)10)9(11,12)13/h3-5,14H,1-2H3.
What are the key properties of [2-fluoro-3-(trifluoromethyl)phenyl]-dimethyl-sulfanyl-λ4-sulfane?
[2-fluoro-3-(trifluoromethyl)phenyl]-dimethyl-sulfanyl-λ4-sulfane has a molecular weight of 258.31 g/mol, XLogP of 4.11, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [2-fluoro-3-(trifluoromethyl)phenyl]-dimethyl-sulfanyl-λ4-sulfane is sourced from PubChem (CID 123175076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).