C12H17ClFN3 — CID 123176518
N-(6-chloro-5-fluoroocta-1,3,5-trien-2-yl)-N'-(methyliminomethyl)ethanimidamide (PubChem CID 123176518) has the molecular formula C12H17ClFN3 and a molecular weight of 257.74 g/mol. Its IUPAC name is N-(6-chloro-5-fluoroocta-1,3,5-trien-2-yl)-N'-(methyliminomethyl)ethanimidamide.
| Compound Name | N-(6-chloro-5-fluoroocta-1,3,5-trien-2-yl)-N'-(methyliminomethyl)ethanimidamide |
|---|---|
| PubChem CID | 123176518 |
| Molecular Formula | C12H17ClFN3 |
| Molecular Weight | 257.74 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | N-(6-chloro-5-fluoroocta-1,3,5-trien-2-yl)-N'-(methyliminomethyl)ethanimidamide |
| SMILES | C=C(C=CC(F)=C(Cl)CC)N/C(C)=N/C=N/C |
| InChI | InChI=1S/C12H17ClFN3/c1-5-11(13)12(14)7-6-9(2)17-10(3)16-8-15-4/h6-8H,2,5H2,1,3-4H3,(H,15,16,17) |
| InChIKey | DXLLSXCIBPSCNJ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.74 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|